C13H15F3O2 — CID 65050039
2-methyl-1-[2-(trifluoromethoxy)phenyl]cyclopentan-1-ol (PubChem CID 65050039) has the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-methyl-1-[2-(trifluoromethoxy)phenyl]cyclopentan-1-ol.
| Compound Name | 2-methyl-1-[2-(trifluoromethoxy)phenyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 65050039 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-methyl-1-[2-(trifluoromethoxy)phenyl]cyclopentan-1-ol |
| SMILES | CC1CCCC1(O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H15F3O2/c1-9-5-4-8-12(9,17)10-6-2-3-7-11(10)18-13(14,15)16/h2-3,6-7,9,17H,4-5,8H2,1H3 |
| InChIKey | HJMFIQVCLKHAFQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |