C14H17F3O2 — CID 80699709
3,3-dimethyl-1-[2-(trifluoromethoxy)phenyl]cyclopentan-1-ol (PubChem CID 80699709) has the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 3,3-dimethyl-1-[2-(trifluoromethoxy)phenyl]cyclopentan-1-ol.
| Compound Name | 3,3-dimethyl-1-[2-(trifluoromethoxy)phenyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 80699709 |
| Molecular Formula | C14H17F3O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3,3-dimethyl-1-[2-(trifluoromethoxy)phenyl]cyclopentan-1-ol |
| SMILES | CC1(C)CCC(O)(c2ccccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C14H17F3O2/c1-12(2)7-8-13(18,9-12)10-5-3-4-6-11(10)19-14(15,16)17/h3-6,18H,7-9H2,1-2H3 |
| InChIKey | DHJGGSWRHCREEF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |