C14H20O2S — CID 79946466
3-(2-methoxyphenyl)-5,5-dimethylthian-3-ol (PubChem CID 79946466) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-5,5-dimethylthian-3-ol.
| Compound Name | 3-(2-methoxyphenyl)-5,5-dimethylthian-3-ol |
|---|---|
| PubChem CID | 79946466 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 3-(2-methoxyphenyl)-5,5-dimethylthian-3-ol |
| SMILES | COc1ccccc1C1(O)CSCC(C)(C)C1 |
| InChI | InChI=1S/C14H20O2S/c1-13(2)8-14(15,10-17-9-13)11-6-4-5-7-12(11)16-3/h4-7,15H,8-10H2,1-3H3 |
| InChIKey | UIVINXGKALLXMP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |