C13H16Cl2OS — CID 79946366
3-(2,3-dichlorophenyl)-5,5-dimethylthian-3-ol (PubChem CID 79946366) has the molecular formula C13H16Cl2OS and a molecular weight of 291.24 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-5,5-dimethylthian-3-ol.
| Compound Name | 3-(2,3-dichlorophenyl)-5,5-dimethylthian-3-ol |
|---|---|
| PubChem CID | 79946366 |
| Molecular Formula | C13H16Cl2OS |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-5,5-dimethylthian-3-ol |
| SMILES | CC1(C)CSCC(O)(c2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C13H16Cl2OS/c1-12(2)6-13(16,8-17-7-12)9-4-3-5-10(14)11(9)15/h3-5,16H,6-8H2,1-2H3 |
| InChIKey | XBBXIMLIMHSPCH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |