About 1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol
1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol (PubChem CID 68815496) has the molecular formula C15H21Cl2NO
and a molecular weight of 302.24 g/mol. Its IUPAC name is 1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol |
| PubChem CID | 68815496 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol |
| SMILES | CCCCN1CCC(O)(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C15H21Cl2NO/c1-2-3-9-18-10-7-15(19,8-11-18)12-5-4-6-13(16)14(12)17/h4-6,19H,2-3,7-11H2,1H3 |
| InChIKey | FIFMBAHXLSRPRC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol?
The IUPAC name of 1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol (CID 68815496) is 1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol.
What is the SMILES notation for 1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol?
The canonical SMILES for 1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol is CCCCN1CCC(O)(c2cccc(Cl)c2Cl)CC1.
What is the InChIKey of 1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol?
The InChIKey is FIFMBAHXLSRPRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21Cl2NO/c1-2-3-9-18-10-7-15(19,8-11-18)12-5-4-6-13(16)14(12)17/h4-6,19H,2-3,7-11H2,1H3.
What are the key properties of 1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol?
1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol has a molecular weight of 302.24 g/mol, XLogP of 4.08, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-(2,3-dichlorophenyl)piperidin-4-ol is sourced from PubChem (CID 68815496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).