C14H24OS — CID 106651318
3-(cyclohepten-1-yl)-5,5-dimethylthian-3-ol (PubChem CID 106651318) has the molecular formula C14H24OS and a molecular weight of 240.41 g/mol. Its IUPAC name is 3-(cyclohepten-1-yl)-5,5-dimethylthian-3-ol.
| Compound Name | 3-(cyclohepten-1-yl)-5,5-dimethylthian-3-ol |
|---|---|
| PubChem CID | 106651318 |
| Molecular Formula | C14H24OS |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 3-(cyclohepten-1-yl)-5,5-dimethylthian-3-ol |
| SMILES | CC1(C)CSCC(O)(C2=CCCCCC2)C1 |
| InChI | InChI=1S/C14H24OS/c1-13(2)9-14(15,11-16-10-13)12-7-5-3-4-6-8-12/h7,15H,3-6,8-11H2,1-2H3 |
| InChIKey | DUZMFNSGNFFSIX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|