C14H19FOS — CID 79947637
3-(4-fluoro-3-methylphenyl)-5,5-dimethylthian-3-ol (PubChem CID 79947637) has the molecular formula C14H19FOS and a molecular weight of 254.37 g/mol. Its IUPAC name is 3-(4-fluoro-3-methylphenyl)-5,5-dimethylthian-3-ol.
| Compound Name | 3-(4-fluoro-3-methylphenyl)-5,5-dimethylthian-3-ol |
|---|---|
| PubChem CID | 79947637 |
| Molecular Formula | C14H19FOS |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-(4-fluoro-3-methylphenyl)-5,5-dimethylthian-3-ol |
| SMILES | Cc1cc(C2(O)CSCC(C)(C)C2)ccc1F |
| InChI | InChI=1S/C14H19FOS/c1-10-6-11(4-5-12(10)15)14(16)7-13(2,3)8-17-9-14/h4-6,16H,7-9H2,1-3H3 |
| InChIKey | CLSGKCAPNDSMGE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |