C11H13ClF3NO — CID 129033013
1-[2-(trifluoromethoxy)phenyl]cyclobutan-1-amine;hydrochloride (PubChem CID 129033013) has the molecular formula C11H13ClF3NO and a molecular weight of 267.68 g/mol. Its IUPAC name is 1-[2-(trifluoromethoxy)phenyl]cyclobutan-1-amine;hydrochloride.
| Compound Name | 1-[2-(trifluoromethoxy)phenyl]cyclobutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 129033013 |
| Molecular Formula | C11H13ClF3NO |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-[2-(trifluoromethoxy)phenyl]cyclobutan-1-amine;hydrochloride |
| SMILES | Cl.NC1(c2ccccc2OC(F)(F)F)CCC1 |
| InChI | InChI=1S/C11H12F3NO.ClH/c12-11(13,14)16-9-5-2-1-4-8(9)10(15)6-3-7-10;/h1-2,4-5H,3,6-7,15H2;1H |
| InChIKey | VTLLAZHMLIHAMV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |