C16H22F2O — CID 63406868
2-tert-butyl-1-(2,4-difluorophenyl)cyclohexan-1-ol (PubChem CID 63406868) has the molecular formula C16H22F2O and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-tert-butyl-1-(2,4-difluorophenyl)cyclohexan-1-ol.
| Compound Name | 2-tert-butyl-1-(2,4-difluorophenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 63406868 |
| Molecular Formula | C16H22F2O |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-tert-butyl-1-(2,4-difluorophenyl)cyclohexan-1-ol |
| SMILES | CC(C)(C)C1CCCCC1(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H22F2O/c1-15(2,3)14-6-4-5-9-16(14,19)12-8-7-11(17)10-13(12)18/h7-8,10,14,19H,4-6,9H2,1-3H3 |
| InChIKey | VBEYHDGDRXWQCU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |