C18H24O2 — CID 114722905
1-(1-benzofuran-2-yl)-2-tert-butylcyclohexan-1-ol (PubChem CID 114722905) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2-tert-butylcyclohexan-1-ol.
| Compound Name | 1-(1-benzofuran-2-yl)-2-tert-butylcyclohexan-1-ol |
|---|---|
| PubChem CID | 114722905 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2-tert-butylcyclohexan-1-ol |
| SMILES | CC(C)(C)C1CCCCC1(O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H24O2/c1-17(2,3)15-10-6-7-11-18(15,19)16-12-13-8-4-5-9-14(13)20-16/h4-5,8-9,12,15,19H,6-7,10-11H2,1-3H3 |
| InChIKey | OWGFNRXIJWOJID-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |