C17H22O2 — CID 114724396
1-(1-benzofuran-2-yl)-2,4,4-trimethylcyclohexan-1-ol (PubChem CID 114724396) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2,4,4-trimethylcyclohexan-1-ol.
| Compound Name | 1-(1-benzofuran-2-yl)-2,4,4-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 114724396 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2,4,4-trimethylcyclohexan-1-ol |
| SMILES | CC1CC(C)(C)CCC1(O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H22O2/c1-12-11-16(2,3)8-9-17(12,18)15-10-13-6-4-5-7-14(13)19-15/h4-7,10,12,18H,8-9,11H2,1-3H3 |
| InChIKey | QSHDMHARTHPOBV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |