C15H19NO2 — CID 23312254
4-(1-benzofuran-2-yl)-1,3-dimethylpiperidin-4-ol (PubChem CID 23312254) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-1,3-dimethylpiperidin-4-ol.
| Compound Name | 4-(1-benzofuran-2-yl)-1,3-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 23312254 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-1,3-dimethylpiperidin-4-ol |
| SMILES | CC1CN(C)CCC1(O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C15H19NO2/c1-11-10-16(2)8-7-15(11,17)14-9-12-5-3-4-6-13(12)18-14/h3-6,9,11,17H,7-8,10H2,1-2H3 |
| InChIKey | XEKKVQGOXZMARC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |