C17H24F2O — CID 105402426
2-tert-butyl-1-[(3,5-difluorophenyl)methyl]cyclohexan-1-ol (PubChem CID 105402426) has the molecular formula C17H24F2O and a molecular weight of 282.37 g/mol. Its IUPAC name is 2-tert-butyl-1-[(3,5-difluorophenyl)methyl]cyclohexan-1-ol.
| Compound Name | 2-tert-butyl-1-[(3,5-difluorophenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 105402426 |
| Molecular Formula | C17H24F2O |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-tert-butyl-1-[(3,5-difluorophenyl)methyl]cyclohexan-1-ol |
| SMILES | CC(C)(C)C1CCCCC1(O)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H24F2O/c1-16(2,3)15-6-4-5-7-17(15,20)11-12-8-13(18)10-14(19)9-12/h8-10,15,20H,4-7,11H2,1-3H3 |
| InChIKey | FSJJLPSQTYZNRK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |