About 4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol
4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol (PubChem CID 105402809) has the molecular formula C13H17F2NO
and a molecular weight of 241.28 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol |
| PubChem CID | 105402809 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol |
| SMILES | CC1CNCCC1(O)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H17F2NO/c1-9-8-16-3-2-13(9,17)7-10-4-11(14)6-12(15)5-10/h4-6,9,16-17H,2-3,7-8H2,1H3 |
| InChIKey | CVNSCRDTIOTXQR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol?
The IUPAC name of 4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol (CID 105402809) is 4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol.
What is the SMILES notation for 4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol?
The canonical SMILES for 4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol is CC1CNCCC1(O)Cc1cc(F)cc(F)c1.
What is the InChIKey of 4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol?
The InChIKey is CVNSCRDTIOTXQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2NO/c1-9-8-16-3-2-13(9,17)7-10-4-11(14)6-12(15)5-10/h4-6,9,16-17H,2-3,7-8H2,1H3.
What are the key properties of 4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol?
4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol has a molecular weight of 241.28 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-difluorophenyl)methyl]-3-methylpiperidin-4-ol is sourced from PubChem (CID 105402809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).