C15H20BrFO — CID 79702276
1-[(3-bromo-5-fluorophenyl)methyl]-2,5-dimethylcyclohexan-1-ol (PubChem CID 79702276) has the molecular formula C15H20BrFO and a molecular weight of 315.23 g/mol. Its IUPAC name is 1-[(3-bromo-5-fluorophenyl)methyl]-2,5-dimethylcyclohexan-1-ol.
| Compound Name | 1-[(3-bromo-5-fluorophenyl)methyl]-2,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 79702276 |
| Molecular Formula | C15H20BrFO |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-[(3-bromo-5-fluorophenyl)methyl]-2,5-dimethylcyclohexan-1-ol |
| SMILES | CC1CCC(C)C(O)(Cc2cc(F)cc(Br)c2)C1 |
| InChI | InChI=1S/C15H20BrFO/c1-10-3-4-11(2)15(18,8-10)9-12-5-13(16)7-14(17)6-12/h5-7,10-11,18H,3-4,8-9H2,1-2H3 |
| InChIKey | ALBZIHFLVNTJFB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |