C19H30O — CID 63407081
2-tert-butyl-1-[(2,5-dimethylphenyl)methyl]cyclohexan-1-ol (PubChem CID 63407081) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is 2-tert-butyl-1-[(2,5-dimethylphenyl)methyl]cyclohexan-1-ol.
| Compound Name | 2-tert-butyl-1-[(2,5-dimethylphenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 63407081 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 2-tert-butyl-1-[(2,5-dimethylphenyl)methyl]cyclohexan-1-ol |
| SMILES | Cc1ccc(C)c(CC2(O)CCCCC2C(C)(C)C)c1 |
| InChI | InChI=1S/C19H30O/c1-14-9-10-15(2)16(12-14)13-19(20)11-7-6-8-17(19)18(3,4)5/h9-10,12,17,20H,6-8,11,13H2,1-5H3 |
| InChIKey | HAOLPCFWDGWISH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |