C15H21ClO — CID 106866029
1-[(2-chloro-4-methylphenyl)methyl]-2-methylcyclohexan-1-ol (PubChem CID 106866029) has the molecular formula C15H21ClO and a molecular weight of 252.78 g/mol. Its IUPAC name is 1-[(2-chloro-4-methylphenyl)methyl]-2-methylcyclohexan-1-ol.
| Compound Name | 1-[(2-chloro-4-methylphenyl)methyl]-2-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 106866029 |
| Molecular Formula | C15H21ClO |
| Molecular Weight | 252.78 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-[(2-chloro-4-methylphenyl)methyl]-2-methylcyclohexan-1-ol |
| SMILES | Cc1ccc(CC2(O)CCCCC2C)c(Cl)c1 |
| InChI | InChI=1S/C15H21ClO/c1-11-6-7-13(14(16)9-11)10-15(17)8-4-3-5-12(15)2/h6-7,9,12,17H,3-5,8,10H2,1-2H3 |
| InChIKey | LFEFSCIBMBZNEX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.78 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |