C13H17ClO — CID 106866034
1-[(2-chloro-4-methylphenyl)methyl]cyclopentan-1-ol (PubChem CID 106866034) has the molecular formula C13H17ClO and a molecular weight of 224.73 g/mol. Its IUPAC name is 1-[(2-chloro-4-methylphenyl)methyl]cyclopentan-1-ol.
| Compound Name | 1-[(2-chloro-4-methylphenyl)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 106866034 |
| Molecular Formula | C13H17ClO |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-[(2-chloro-4-methylphenyl)methyl]cyclopentan-1-ol |
| SMILES | Cc1ccc(CC2(O)CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClO/c1-10-4-5-11(12(14)8-10)9-13(15)6-2-3-7-13/h4-5,8,15H,2-3,6-7,9H2,1H3 |
| InChIKey | ZGACOXVLKORCOL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |