C16H21ClO2 — CID 106867191
2-(2-chloro-4-methylphenyl)-1-(1-hydroxycycloheptyl)ethanone (PubChem CID 106867191) has the molecular formula C16H21ClO2 and a molecular weight of 280.80 g/mol. Its IUPAC name is 2-(2-chloro-4-methylphenyl)-1-(1-hydroxycycloheptyl)ethanone.
| Compound Name | 2-(2-chloro-4-methylphenyl)-1-(1-hydroxycycloheptyl)ethanone |
|---|---|
| PubChem CID | 106867191 |
| Molecular Formula | C16H21ClO2 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-(2-chloro-4-methylphenyl)-1-(1-hydroxycycloheptyl)ethanone |
| SMILES | Cc1ccc(CC(=O)C2(O)CCCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClO2/c1-12-6-7-13(14(17)10-12)11-15(18)16(19)8-4-2-3-5-9-16/h6-7,10,19H,2-5,8-9,11H2,1H3 |
| InChIKey | TVPMLFDFNWUHID-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |