C16H21NO — CID 106663926
1-(1H-indol-4-yl)-2,4,4-trimethylcyclopentan-1-ol (PubChem CID 106663926) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-(1H-indol-4-yl)-2,4,4-trimethylcyclopentan-1-ol.
| Compound Name | 1-(1H-indol-4-yl)-2,4,4-trimethylcyclopentan-1-ol |
|---|---|
| PubChem CID | 106663926 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 1-(1H-indol-4-yl)-2,4,4-trimethylcyclopentan-1-ol |
| SMILES | CC1CC(C)(C)CC1(O)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C16H21NO/c1-11-9-15(2,3)10-16(11,18)13-5-4-6-14-12(13)7-8-17-14/h4-8,11,17-18H,9-10H2,1-3H3 |
| InChIKey | JXNIWMCYPAOGRO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |