About 4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole
4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole (PubChem CID 89021879) has the molecular formula C20H26N2
and a molecular weight of 294.44 g/mol. Its IUPAC name is 4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole.
Molecular Properties
| Compound Name | 4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole |
| PubChem CID | 89021879 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole |
| SMILES | C=C(c1cccc2[nH]ccc12)N1CC2(C)CC1CC(C)(C)C2 |
| InChI | InChI=1S/C20H26N2/c1-14(16-6-5-7-18-17(16)8-9-21-18)22-13-20(4)11-15(22)10-19(2,3)12-20/h5-9,15,21H,1,10-13H2,2-4H3 |
| InChIKey | ZWOJNEFBLFRXJM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole?
The IUPAC name of 4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole (CID 89021879) is 4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole.
What is the SMILES notation for 4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole?
The canonical SMILES for 4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole is C=C(c1cccc2[nH]ccc12)N1CC2(C)CC1CC(C)(C)C2.
What is the InChIKey of 4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole?
The InChIKey is ZWOJNEFBLFRXJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2/c1-14(16-6-5-7-18-17(16)8-9-21-18)22-13-20(4)11-15(22)10-19(2,3)12-20/h5-9,15,21H,1,10-13H2,2-4H3.
What are the key properties of 4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole?
4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole has a molecular weight of 294.44 g/mol, XLogP of 5.04, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethenyl]-1H-indole is sourced from PubChem (CID 89021879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).