C12H17F2NOS2 — CID 164565468
5-(2,4-difluorophenyl)-3,3-dimethyldithiolan-4-ol;methanamine (PubChem CID 164565468) has the molecular formula C12H17F2NOS2 and a molecular weight of 293.40 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-3,3-dimethyldithiolan-4-ol;methanamine.
| Compound Name | 5-(2,4-difluorophenyl)-3,3-dimethyldithiolan-4-ol;methanamine |
|---|---|
| PubChem CID | 164565468 |
| Molecular Formula | C12H17F2NOS2 |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 5-(2,4-difluorophenyl)-3,3-dimethyldithiolan-4-ol;methanamine |
| SMILES | CC1(C)SSC(c2ccc(F)cc2F)C1O.CN |
| InChI | InChI=1S/C11H12F2OS2.CH5N/c1-11(2)10(14)9(15-16-11)7-4-3-6(12)5-8(7)13;1-2/h3-5,9-10,14H,1-2H3;2H2,1H3 |
| InChIKey | SNVFOSHGPIMDSX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|