C18H25NO3 — CID 10402736
(3aR,9R,9aR,9bS)-2,2-dimethyl-9-phenylmethoxy-3a,4,6,7,8,9,9a,9b-octahydro-[1,3]dioxolo[4,5-a]indolizine (PubChem CID 10402736) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (3aR,9R,9aR,9bS)-2,2-dimethyl-9-phenylmethoxy-3a,4,6,7,8,9,9a,9b-octahydro-[1,3]dioxolo[4,5-a]indolizine.
| Compound Name | (3aR,9R,9aR,9bS)-2,2-dimethyl-9-phenylmethoxy-3a,4,6,7,8,9,9a,9b-octahydro-[1,3]dioxolo[4,5-a]indolizine |
|---|---|
| PubChem CID | 10402736 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (3aR,9R,9aR,9bS)-2,2-dimethyl-9-phenylmethoxy-3a,4,6,7,8,9,9a,9b-octahydro-[1,3]dioxolo[4,5-a]indolizine |
| SMILES | CC1(C)O[C@H]2[C@H]3[C@H](OCc4ccccc4)CCCN3C[C@H]2O1 |
| InChI | InChI=1S/C18H25NO3/c1-18(2)21-15-11-19-10-6-9-14(16(19)17(15)22-18)20-12-13-7-4-3-5-8-13/h3-5,7-8,14-17H,6,9-12H2,1-2H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | HCJFXNSKTMCSCN-QBPKDAKJSA-N |
| XLogP | 2.57 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |