C18H21NO4 — CID 134957041
(1S,6R,7R)-11-ethynyl-4,4-dimethyl-11-phenyl-3,5,12-trioxa-9-azatricyclo[7.3.0.02,6]dodecan-7-ol (PubChem CID 134957041) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is (1S,6R,7R)-11-ethynyl-4,4-dimethyl-11-phenyl-3,5,12-trioxa-9-azatricyclo[7.3.0.02,6]dodecan-7-ol.
| Compound Name | (1S,6R,7R)-11-ethynyl-4,4-dimethyl-11-phenyl-3,5,12-trioxa-9-azatricyclo[7.3.0.02,6]dodecan-7-ol |
|---|---|
| PubChem CID | 134957041 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (1S,6R,7R)-11-ethynyl-4,4-dimethyl-11-phenyl-3,5,12-trioxa-9-azatricyclo[7.3.0.02,6]dodecan-7-ol |
| SMILES | C#CC1(c2ccccc2)CN2C[C@@H](O)[C@H]3OC(C)(C)OC3[C@@H]2O1 |
| InChI | InChI=1S/C18H21NO4/c1-4-18(12-8-6-5-7-9-12)11-19-10-13(20)14-15(16(19)23-18)22-17(2,3)21-14/h1,5-9,13-16,20H,10-11H2,2-3H3/t13-,14-,15?,16+,18?/m1/s1 |
| InChIKey | SVNNVLRQPMSRIF-FTRJEVOPSA-N |
| XLogP | 1.07 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|