C20H29NO3 — CID 134848208
(1S,2S,4R,5S,7R,8R)-7,10-dimethyl-5-phenylmethoxy-12-azatricyclo[6.3.1.04,12]dodecane-2,10-diol (PubChem CID 134848208) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (1S,2S,4R,5S,7R,8R)-7,10-dimethyl-5-phenylmethoxy-12-azatricyclo[6.3.1.04,12]dodecane-2,10-diol.
| Compound Name | (1S,2S,4R,5S,7R,8R)-7,10-dimethyl-5-phenylmethoxy-12-azatricyclo[6.3.1.04,12]dodecane-2,10-diol |
|---|---|
| PubChem CID | 134848208 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (1S,2S,4R,5S,7R,8R)-7,10-dimethyl-5-phenylmethoxy-12-azatricyclo[6.3.1.04,12]dodecane-2,10-diol |
| SMILES | C[C@@H]1C[C@H](OCc2ccccc2)[C@H]2C[C@H](O)[C@@H]3CC(C)(O)C[C@H]1N23 |
| InChI | InChI=1S/C20H29NO3/c1-13-8-19(24-12-14-6-4-3-5-7-14)15-9-18(22)17-11-20(2,23)10-16(13)21(15)17/h3-7,13,15-19,22-23H,8-12H2,1-2H3/t13-,15-,16-,17+,18+,19+,20?/m1/s1 |
| InChIKey | RMPUKRIQSJOFJY-ZGRXSMBPSA-N |
| XLogP | 2.33 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |