C21H31NO2 — CID 11450312
(1R,2R,3E,9aS)-1-methyl-3-(2-methylpropylidene)-1-phenylmethoxy-4,6,7,8,9,9a-hexahydro-2H-quinolizin-2-ol (PubChem CID 11450312) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is (1R,2R,3E,9aS)-1-methyl-3-(2-methylpropylidene)-1-phenylmethoxy-4,6,7,8,9,9a-hexahydro-2H-quinolizin-2-ol.
| Compound Name | (1R,2R,3E,9aS)-1-methyl-3-(2-methylpropylidene)-1-phenylmethoxy-4,6,7,8,9,9a-hexahydro-2H-quinolizin-2-ol |
|---|---|
| PubChem CID | 11450312 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | (1R,2R,3E,9aS)-1-methyl-3-(2-methylpropylidene)-1-phenylmethoxy-4,6,7,8,9,9a-hexahydro-2H-quinolizin-2-ol |
| SMILES | CC(C)/C=C1\CN2CCCC[C@H]2[C@@](C)(OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C21H31NO2/c1-16(2)13-18-14-22-12-8-7-11-19(22)21(3,20(18)23)24-15-17-9-5-4-6-10-17/h4-6,9-10,13,16,19-20,23H,7-8,11-12,14-15H2,1-3H3/b18-13+/t19-,20+,21+/m0/s1 |
| InChIKey | JDTZTDYRNHHTSL-SBEUHDIBSA-N |
| XLogP | 3.77 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|