C32H53NO2Si — CID 11113957
[(6Z,8S,8aS)-6-[(E,2R,6S)-2,5-dimethyl-6-phenylmethoxyoct-4-enylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11113957) has the molecular formula C32H53NO2Si and a molecular weight of 511.87 g/mol. Its IUPAC name is [(6Z,8S,8aS)-6-[(E,2R,6S)-2,5-dimethyl-6-phenylmethoxyoct-4-enylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(6Z,8S,8aS)-6-[(E,2R,6S)-2,5-dimethyl-6-phenylmethoxyoct-4-enylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11113957 |
| Molecular Formula | C32H53NO2Si |
| Molecular Weight | 511.87 g/mol |
| Exact Mass | 511.38 |
| IUPAC Name | [(6Z,8S,8aS)-6-[(E,2R,6S)-2,5-dimethyl-6-phenylmethoxyoct-4-enylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC[C@H](OCc1ccccc1)/C(C)=C/C[C@@H](C)/C=C1\CN2CCC[C@H]2[C@@](C)(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C32H53NO2Si/c1-10-29(34-24-27-15-12-11-13-16-27)26(3)19-18-25(2)21-28-22-32(7,30-17-14-20-33(30)23-28)35-36(8,9)31(4,5)6/h11-13,15-16,19,21,25,29-30H,10,14,17-18,20,22-24H2,1-9H3/b26-19+,28-21-/t25-,29+,30+,32+/m1/s1 |
| InChIKey | LSVUBLCQJKEQBA-RTGAZLORSA-N |
| XLogP | 8.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.87 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|