C21H33NO2Si — CID 135075829
trimethyl-[(2E)-3-methyl-4-[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]penta-2,4-dienoxy]silane (PubChem CID 135075829) has the molecular formula C21H33NO2Si and a molecular weight of 359.59 g/mol. Its IUPAC name is trimethyl-[(2E)-3-methyl-4-[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]penta-2,4-dienoxy]silane.
| Compound Name | trimethyl-[(2E)-3-methyl-4-[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]penta-2,4-dienoxy]silane |
|---|---|
| PubChem CID | 135075829 |
| Molecular Formula | C21H33NO2Si |
| Molecular Weight | 359.59 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | trimethyl-[(2E)-3-methyl-4-[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]penta-2,4-dienoxy]silane |
| SMILES | C=C(/C(C)=C/CO[Si](C)(C)C)N1CCC[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C21H33NO2Si/c1-18(13-15-24-25(3,4)5)19(2)22-14-9-12-21(22)17-23-16-20-10-7-6-8-11-20/h6-8,10-11,13,21H,2,9,12,14-17H2,1,3-5H3/b18-13+/t21-/m0/s1 |
| InChIKey | UMLLCYSYMCJDTD-DOIQENQNSA-N |
| XLogP | 4.98 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|