C35H55NO2Si2 — CID 11767016
[(2S,3Z)-3-[(8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-6-ylidene]-2-methylpropoxy]-tert-butyl-diphenylsilane (PubChem CID 11767016) has the molecular formula C35H55NO2Si2 and a molecular weight of 578.00 g/mol. Its IUPAC name is [(2S,3Z)-3-[(8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-6-ylidene]-2-methylpropoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2S,3Z)-3-[(8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-6-ylidene]-2-methylpropoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11767016 |
| Molecular Formula | C35H55NO2Si2 |
| Molecular Weight | 578.00 g/mol |
| Exact Mass | 577.38 |
| IUPAC Name | [(2S,3Z)-3-[(8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-6-ylidene]-2-methylpropoxy]-tert-butyl-diphenylsilane |
| SMILES | C[C@@H](/C=C1\CN2CCC[C@H]2[C@@](C)(O[Si](C)(C)C(C)(C)C)C1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H55NO2Si2/c1-28(24-29-25-35(8,32-22-17-23-36(32)26-29)38-39(9,10)33(2,3)4)27-37-40(34(5,6)7,30-18-13-11-14-19-30)31-20-15-12-16-21-31/h11-16,18-21,24,28,32H,17,22-23,25-27H2,1-10H3/b29-24-/t28-,32-,35-/m0/s1 |
| InChIKey | OTZQASJXBOTZJX-WWXOVPRPSA-N |
| XLogP | 7.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.00 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|