C29H41NOSi — CID 11510637
[(E)-4-[(5S,8R,8aS)-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]but-3-enoxy]-tert-butyl-diphenylsilane (PubChem CID 11510637) has the molecular formula C29H41NOSi and a molecular weight of 447.74 g/mol. Its IUPAC name is [(E)-4-[(5S,8R,8aS)-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]but-3-enoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(E)-4-[(5S,8R,8aS)-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]but-3-enoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11510637 |
| Molecular Formula | C29H41NOSi |
| Molecular Weight | 447.74 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | [(E)-4-[(5S,8R,8aS)-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]but-3-enoxy]-tert-butyl-diphenylsilane |
| SMILES | C[C@@H]1CC[C@@H](/C=C/CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N2CCC[C@@H]12 |
| InChI | InChI=1S/C29H41NOSi/c1-24-20-21-25(30-22-13-19-28(24)30)14-11-12-23-31-32(29(2,3)4,26-15-7-5-8-16-26)27-17-9-6-10-18-27/h5-11,14-18,24-25,28H,12-13,19-23H2,1-4H3/b14-11+/t24-,25-,28+/m1/s1 |
| InChIKey | CPMQMVBOPIXMOB-LHUAGFRYSA-N |
| XLogP | 5.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.74 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|