C29H41NO2Si — CID 10895879
(6Z,8S,8aS)-6-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol (PubChem CID 10895879) has the molecular formula C29H41NO2Si and a molecular weight of 463.74 g/mol. Its IUPAC name is (6Z,8S,8aS)-6-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol.
| Compound Name | (6Z,8S,8aS)-6-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
|---|---|
| PubChem CID | 10895879 |
| Molecular Formula | C29H41NO2Si |
| Molecular Weight | 463.74 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | (6Z,8S,8aS)-6-[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-methylpropylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
| SMILES | C[C@@H](/C=C1\CN2CCC[C@H]2[C@@](C)(O)C1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H41NO2Si/c1-23(19-24-20-29(5,31)27-17-12-18-30(27)21-24)22-32-33(28(2,3)4,25-13-8-6-9-14-25)26-15-10-7-11-16-26/h6-11,13-16,19,23,27,31H,12,17-18,20-22H2,1-5H3/b24-19-/t23-,27-,29-/m0/s1 |
| InChIKey | DMMMYASUUUXHCL-GRWKFTGQSA-N |
| XLogP | 4.74 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.74 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|