C30H43NOSi — CID 101384940
[(E)-4-[(5S,8R,8aS)-8-ethyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]but-3-enoxy]-tert-butyl-diphenylsilane (PubChem CID 101384940) has the molecular formula C30H43NOSi and a molecular weight of 461.77 g/mol. Its IUPAC name is [(E)-4-[(5S,8R,8aS)-8-ethyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]but-3-enoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(E)-4-[(5S,8R,8aS)-8-ethyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]but-3-enoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 101384940 |
| Molecular Formula | C30H43NOSi |
| Molecular Weight | 461.77 g/mol |
| Exact Mass | 461.31 |
| IUPAC Name | [(E)-4-[(5S,8R,8aS)-8-ethyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]but-3-enoxy]-tert-butyl-diphenylsilane |
| SMILES | CC[C@@H]1CC[C@@H](/C=C/CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N2CCC[C@@H]12 |
| InChI | InChI=1S/C30H43NOSi/c1-5-25-21-22-26(31-23-14-20-29(25)31)15-12-13-24-32-33(30(2,3)4,27-16-8-6-9-17-27)28-18-10-7-11-19-28/h6-12,15-19,25-26,29H,5,13-14,20-24H2,1-4H3/b15-12+/t25-,26-,29+/m1/s1 |
| InChIKey | BATFTIIERNLAID-NDDJPVJNSA-N |
| XLogP | 6.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.77 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|