C23H34NSi — CID 10594250
CID 10594250 (PubChem CID 10594250) has the molecular formula C23H34NSi and a molecular weight of 352.62 g/mol.
| Compound Name | CID 10594250 |
|---|---|
| PubChem CID | 10594250 |
| Molecular Formula | C23H34NSi |
| Molecular Weight | 352.62 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | — |
| SMILES | C[Si](C[C@@H]1/C(=C/C2CCCCC2)CCN2CCC[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C23H34NSi/c1-25(21-11-6-3-7-12-21)18-22-20(17-19-9-4-2-5-10-19)14-16-24-15-8-13-23(22)24/h3,6-7,11-12,17,19,22-23H,2,4-5,8-10,13-16,18H2,1H3/b20-17+/t22-,23+/m1/s1 |
| InChIKey | GVCOOADXKCUQNW-LOGOXWLHSA-N |
| XLogP | 5.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.62 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|