C23H33NSi — CID 13292194
dimethyl-[4-(2-methyl-3-piperidin-1-ylpropyl)phenyl]-phenylsilane (PubChem CID 13292194) has the molecular formula C23H33NSi and a molecular weight of 351.61 g/mol. Its IUPAC name is dimethyl-[4-(2-methyl-3-piperidin-1-ylpropyl)phenyl]-phenylsilane.
| Compound Name | dimethyl-[4-(2-methyl-3-piperidin-1-ylpropyl)phenyl]-phenylsilane |
|---|---|
| PubChem CID | 13292194 |
| Molecular Formula | C23H33NSi |
| Molecular Weight | 351.61 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | dimethyl-[4-(2-methyl-3-piperidin-1-ylpropyl)phenyl]-phenylsilane |
| SMILES | CC(Cc1ccc([Si](C)(C)c2ccccc2)cc1)CN1CCCCC1 |
| InChI | InChI=1S/C23H33NSi/c1-20(19-24-16-8-5-9-17-24)18-21-12-14-23(15-13-21)25(2,3)22-10-6-4-7-11-22/h4,6-7,10-15,20H,5,8-9,16-19H2,1-3H3 |
| InChIKey | VSLOBHCLYQERSR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|