About dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane
dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane (PubChem CID 10428029) has the molecular formula C23H33NSi
and a molecular weight of 351.61 g/mol. Its IUPAC name is dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane.
Molecular Properties
| Compound Name | dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane |
| PubChem CID | 10428029 |
| Molecular Formula | C23H33NSi |
| Molecular Weight | 351.61 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane |
| SMILES | CC([C@@H](C)[C@H](c1ccccc1)[Si](C)(C)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C23H33NSi/c1-19(20(2)24-17-11-12-18-24)23(21-13-7-5-8-14-21)25(3,4)22-15-9-6-10-16-22/h5-10,13-16,19-20,23H,11-12,17-18H2,1-4H3/t19-,20?,23-/m1/s1 |
| InChIKey | XLOJZFGPGOUXML-GGFVOEBESA-N |
| XLogP | 5.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane?
The IUPAC name of dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane (CID 10428029) is dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane.
What is the SMILES notation for dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane?
The canonical SMILES for dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane is CC([C@@H](C)[C@H](c1ccccc1)[Si](C)(C)c1ccccc1)N1CCCC1.
What is the InChIKey of dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane?
The InChIKey is XLOJZFGPGOUXML-GGFVOEBESA-N. The full InChI is InChI=1S/C23H33NSi/c1-19(20(2)24-17-11-12-18-24)23(21-13-7-5-8-14-21)25(3,4)22-15-9-6-10-16-22/h5-10,13-16,19-20,23H,11-12,17-18H2,1-4H3/t19-,20?,23-/m1/s1.
What are the key properties of dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane?
dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane has a molecular weight of 351.61 g/mol, XLogP of 5.05, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[(1R,2R)-2-methyl-1-phenyl-3-pyrrolidin-1-ylbutyl]-phenylsilane is sourced from PubChem (CID 10428029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).