About (2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine
(2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine (PubChem CID 10470490) has the molecular formula C22H29N
and a molecular weight of 307.48 g/mol. Its IUPAC name is (2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine.
Molecular Properties
| Compound Name | (2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine |
| PubChem CID | 10470490 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | (2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine |
| SMILES | CN1[C@@H](CCc2ccccc2)CCC[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C22H29N/c1-23-21(17-15-19-9-4-2-5-10-19)13-8-14-22(23)18-16-20-11-6-3-7-12-20/h2-7,9-12,21-22H,8,13-18H2,1H3/t21-,22+ |
| InChIKey | ISVBJSRQEBWKPB-SZPZYZBQSA-N |
| XLogP | 5.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine?
The IUPAC name of (2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine (CID 10470490) is (2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine.
What is the SMILES notation for (2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine?
The canonical SMILES for (2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine is CN1[C@@H](CCc2ccccc2)CCC[C@H]1CCc1ccccc1.
What is the InChIKey of (2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine?
The InChIKey is ISVBJSRQEBWKPB-SZPZYZBQSA-N. The full InChI is InChI=1S/C22H29N/c1-23-21(17-15-19-9-4-2-5-10-19)13-8-14-22(23)18-16-20-11-6-3-7-12-20/h2-7,9-12,21-22H,8,13-18H2,1H3/t21-,22+.
What are the key properties of (2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine?
(2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine has a molecular weight of 307.48 g/mol, XLogP of 5.10, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-1-methyl-2,6-bis(2-phenylethyl)piperidine is sourced from PubChem (CID 10470490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).