C20H23N — CID 14906162
2,8-diphenyl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 14906162) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 2,8-diphenyl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 2,8-diphenyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 14906162 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 2,8-diphenyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | c1ccc(C2CC3C(c4ccccc4)CCCN3C2)cc1 |
| InChI | InChI=1S/C20H23N/c1-3-8-16(9-4-1)18-14-20-19(12-7-13-21(20)15-18)17-10-5-2-6-11-17/h1-6,8-11,18-20H,7,12-15H2 |
| InChIKey | KPPZRDIHYDLAQD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |