C26H37NOSi — CID 134864911
[(2S,3aS,7aS)-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 134864911) has the molecular formula C26H37NOSi and a molecular weight of 407.67 g/mol. Its IUPAC name is [(2S,3aS,7aS)-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S,3aS,7aS)-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134864911 |
| Molecular Formula | C26H37NOSi |
| Molecular Weight | 407.67 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | [(2S,3aS,7aS)-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CN1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C26H37NOSi/c1-26(2,3)29(23-14-7-5-8-15-23,24-16-9-6-10-17-24)28-20-22-19-21-13-11-12-18-25(21)27(22)4/h5-10,14-17,21-22,25H,11-13,18-20H2,1-4H3/t21-,22-,25-/m0/s1 |
| InChIKey | YMERNVRJOFITEK-HWBMXIPRSA-N |
| XLogP | 4.83 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|