C22H31NO2Si — CID 165162966
[(2S,4S)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]-1-methylpyrrolidin-2-yl]methanol (PubChem CID 165162966) has the molecular formula C22H31NO2Si and a molecular weight of 369.58 g/mol. Its IUPAC name is [(2S,4S)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]-1-methylpyrrolidin-2-yl]methanol.
| Compound Name | [(2S,4S)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]-1-methylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 165162966 |
| Molecular Formula | C22H31NO2Si |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [(2S,4S)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]-1-methylpyrrolidin-2-yl]methanol |
| SMILES | CN1C[C@H](CC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)C[C@H]1CO |
| InChI | InChI=1S/C22H31NO2Si/c1-22(2,15-18-14-19(17-24)23(3)16-18)26(25,20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-13,18-19,24-25H,14-17H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | GZHPANCRUNASLW-OALUTQOASA-N |
| XLogP | 2.22 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|