C24H35NO2Si — CID 11211674
[(2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-1-methylpyrrolidin-2-yl]methanol (PubChem CID 11211674) has the molecular formula C24H35NO2Si and a molecular weight of 397.63 g/mol. Its IUPAC name is [(2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-1-methylpyrrolidin-2-yl]methanol.
| Compound Name | [(2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-1-methylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 11211674 |
| Molecular Formula | C24H35NO2Si |
| Molecular Weight | 397.63 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | [(2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-ethyl-1-methylpyrrolidin-2-yl]methanol |
| SMILES | CC[C@@]1(CO)C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CN1C |
| InChI | InChI=1S/C24H35NO2Si/c1-6-24(19-26)17-20(18-25(24)5)27-28(23(2,3)4,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,26H,6,17-19H2,1-5H3/t20-,24+/m1/s1 |
| InChIKey | ORWREGAQHWBPAX-YKSBVNFPSA-N |
| XLogP | 3.41 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.63 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|