C23H39NO2Si — CID 10023254
1-[(2S)-2-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl-dimethylsilyl]-2-phenylethyl]cyclohexan-1-ol (PubChem CID 10023254) has the molecular formula C23H39NO2Si and a molecular weight of 389.66 g/mol. Its IUPAC name is 1-[(2S)-2-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl-dimethylsilyl]-2-phenylethyl]cyclohexan-1-ol.
| Compound Name | 1-[(2S)-2-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl-dimethylsilyl]-2-phenylethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10023254 |
| Molecular Formula | C23H39NO2Si |
| Molecular Weight | 389.66 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | 1-[(2S)-2-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl-dimethylsilyl]-2-phenylethyl]cyclohexan-1-ol |
| SMILES | COC[C@@H]1CCCN1C[Si](C)(C)[C@@H](CC1(O)CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H39NO2Si/c1-26-18-21-13-10-16-24(21)19-27(2,3)22(20-11-6-4-7-12-20)17-23(25)14-8-5-9-15-23/h4,6-7,11-12,21-22,25H,5,8-10,13-19H2,1-3H3/t21-,22-/m0/s1 |
| InChIKey | XYYPFLMZHXXFIX-VXKWHMMOSA-N |
| XLogP | 4.75 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.66 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|