C16H26LiNOSi — CID 10107896
lithium [(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl-dimethyl-(phenylmethyl)silane (PubChem CID 10107896) has the molecular formula C16H26LiNOSi and a molecular weight of 283.42 g/mol. Its IUPAC name is lithium [(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl-dimethyl-(phenylmethyl)silane.
| Compound Name | lithium [(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl-dimethyl-(phenylmethyl)silane |
|---|---|
| PubChem CID | 10107896 |
| Molecular Formula | C16H26LiNOSi |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | lithium [(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methyl-dimethyl-(phenylmethyl)silane |
| SMILES | COC[C@@H]1CCCN1C[Si](C)(C)[CH-]c1ccccc1.[Li+] |
| InChI | InChI=1S/C16H26NOSi.Li/c1-18-12-16-10-7-11-17(16)14-19(2,3)13-15-8-5-4-6-9-15;/h4-6,8-9,13,16H,7,10-12,14H2,1-3H3;/q-1;+1/t16-;/m0./s1 |
| InChIKey | RPXPZKLHMXXWTG-NTISSMGPSA-N |
| XLogP | 0.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|