C29H51NO4Si — CID 135012008
tert-butyl-[[(4S,6S)-6-[(2R,4R)-4-[(4S,5S)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]pentan-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]methoxy]-dimethylsilane (PubChem CID 135012008) has the molecular formula C29H51NO4Si and a molecular weight of 505.82 g/mol. Its IUPAC name is tert-butyl-[[(4S,6S)-6-[(2R,4R)-4-[(4S,5S)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]pentan-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4S,6S)-6-[(2R,4R)-4-[(4S,5S)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]pentan-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135012008 |
| Molecular Formula | C29H51NO4Si |
| Molecular Weight | 505.82 g/mol |
| Exact Mass | 505.36 |
| IUPAC Name | tert-butyl-[[(4S,6S)-6-[(2R,4R)-4-[(4S,5S)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]pentan-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]methoxy]-dimethylsilane |
| SMILES | C[C@H](C[C@@H](C)[C@@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)OC(C)(C)O1)C1O[C@@H](c2ccccc2)[C@H](C)N1C |
| InChI | InChI=1S/C29H51NO4Si/c1-20(17-21(2)27-30(9)22(3)26(32-27)23-15-13-12-14-16-23)25-18-24(33-29(7,8)34-25)19-31-35(10,11)28(4,5)6/h12-16,20-22,24-27H,17-19H2,1-11H3/t20-,21-,22+,24+,25+,26-,27?/m1/s1 |
| InChIKey | PMACWQZIRULAOP-XRIVVSEVSA-N |
| XLogP | 7.00 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.82 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|