C16H23NO2 — CID 11021657
(2R,4R,5S)-3,4-dimethyl-2-[(3R)-oxan-3-yl]-5-phenyl-1,3-oxazolidine (PubChem CID 11021657) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is (2R,4R,5S)-3,4-dimethyl-2-[(3R)-oxan-3-yl]-5-phenyl-1,3-oxazolidine.
| Compound Name | (2R,4R,5S)-3,4-dimethyl-2-[(3R)-oxan-3-yl]-5-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 11021657 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (2R,4R,5S)-3,4-dimethyl-2-[(3R)-oxan-3-yl]-5-phenyl-1,3-oxazolidine |
| SMILES | C[C@@H]1[C@H](c2ccccc2)O[C@H]([C@@H]2CCCOC2)N1C |
| InChI | InChI=1S/C16H23NO2/c1-12-15(13-7-4-3-5-8-13)19-16(17(12)2)14-9-6-10-18-11-14/h3-5,7-8,12,14-16H,6,9-11H2,1-2H3/t12-,14-,15-,16-/m1/s1 |
| InChIKey | CTGDRNFDKTXTMH-DTZQCDIJSA-N |
| XLogP | 2.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |