C37H65NO4Si — CID 101419344
[(3aR,8S,8aR,9R,9aR)-2,2-dimethyl-8-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-3a,4,6,7,8,8a,9,9a-octahydro-[1,3]dioxolo[4,5-f]indolizin-9-yl]oxy-tri(propan-2-yl)silane (PubChem CID 101419344) has the molecular formula C37H65NO4Si and a molecular weight of 616.02 g/mol. Its IUPAC name is [(3aR,8S,8aR,9R,9aR)-2,2-dimethyl-8-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-3a,4,6,7,8,8a,9,9a-octahydro-[1,3]dioxolo[4,5-f]indolizin-9-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3aR,8S,8aR,9R,9aR)-2,2-dimethyl-8-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-3a,4,6,7,8,8a,9,9a-octahydro-[1,3]dioxolo[4,5-f]indolizin-9-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101419344 |
| Molecular Formula | C37H65NO4Si |
| Molecular Weight | 616.02 g/mol |
| Exact Mass | 615.47 |
| IUPAC Name | [(3aR,8S,8aR,9R,9aR)-2,2-dimethyl-8-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-3a,4,6,7,8,8a,9,9a-octahydro-[1,3]dioxolo[4,5-f]indolizin-9-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)c1cc(C(C)C)c(C(C)O[C@H]2CCN3C[C@H]4OC(C)(C)O[C@H]4[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]23)c(C(C)C)c1 |
| InChI | InChI=1S/C37H65NO4Si/c1-21(2)28-18-29(22(3)4)33(30(19-28)23(5)6)27(13)39-31-16-17-38-20-32-35(41-37(14,15)40-32)36(34(31)38)42-43(24(7)8,25(9)10)26(11)12/h18-19,21-27,31-32,34-36H,16-17,20H2,1-15H3/t27?,31-,32+,34+,35+,36+/m0/s1 |
| InChIKey | SKPUQSAWTZSMHE-JWORITEASA-N |
| XLogP | 9.67 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.02 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|