C37H63NO5Si — CID 101419347
(3aR,8S,8aR,9R,9aR)-2,2-dimethyl-8-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-9-tri(propan-2-yl)silyloxy-4,7,8,8a,9,9a-hexahydro-3aH-[1,3]dioxolo[4,5-f]indolizin-6-one (PubChem CID 101419347) has the molecular formula C37H63NO5Si and a molecular weight of 630.00 g/mol. Its IUPAC name is (3aR,8S,8aR,9R,9aR)-2,2-dimethyl-8-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-9-tri(propan-2-yl)silyloxy-4,7,8,8a,9,9a-hexahydro-3aH-[1,3]dioxolo[4,5-f]indolizin-6-one.
| Compound Name | (3aR,8S,8aR,9R,9aR)-2,2-dimethyl-8-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-9-tri(propan-2-yl)silyloxy-4,7,8,8a,9,9a-hexahydro-3aH-[1,3]dioxolo[4,5-f]indolizin-6-one |
|---|---|
| PubChem CID | 101419347 |
| Molecular Formula | C37H63NO5Si |
| Molecular Weight | 630.00 g/mol |
| Exact Mass | 629.45 |
| IUPAC Name | (3aR,8S,8aR,9R,9aR)-2,2-dimethyl-8-[1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-9-tri(propan-2-yl)silyloxy-4,7,8,8a,9,9a-hexahydro-3aH-[1,3]dioxolo[4,5-f]indolizin-6-one |
| SMILES | CC(C)c1cc(C(C)C)c(C(C)O[C@H]2CC(=O)N3C[C@H]4OC(C)(C)O[C@H]4[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]23)c(C(C)C)c1 |
| InChI | InChI=1S/C37H63NO5Si/c1-20(2)27-16-28(21(3)4)33(29(17-27)22(5)6)26(13)40-30-18-32(39)38-19-31-35(42-37(14,15)41-31)36(34(30)38)43-44(23(7)8,24(9)10)25(11)12/h16-17,20-26,30-31,34-36H,18-19H2,1-15H3/t26?,30-,31+,34+,35+,36+/m0/s1 |
| InChIKey | HBZYTCYZVHGIMO-GEOGBSIGSA-N |
| XLogP | 9.20 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.00 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|