C38H65NO5Si — CID 42639033
(4S,5R)-1-[2-(methoxymethoxy)prop-2-enyl]-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]pyrrolidin-2-one (PubChem CID 42639033) has the molecular formula C38H65NO5Si and a molecular weight of 644.03 g/mol. Its IUPAC name is (4S,5R)-1-[2-(methoxymethoxy)prop-2-enyl]-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]pyrrolidin-2-one.
| Compound Name | (4S,5R)-1-[2-(methoxymethoxy)prop-2-enyl]-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 42639033 |
| Molecular Formula | C38H65NO5Si |
| Molecular Weight | 644.03 g/mol |
| Exact Mass | 643.46 |
| IUPAC Name | (4S,5R)-1-[2-(methoxymethoxy)prop-2-enyl]-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-5-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]pyrrolidin-2-one |
| SMILES | C=C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1[C@@H](O[C@H](C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)CC(=O)N1CC(=C)OCOC |
| InChI | InChI=1S/C38H65NO5Si/c1-17-34(44-45(26(8)9,27(10)11)28(12)13)38-35(20-36(40)39(38)21-29(14)42-22-41-16)43-30(15)37-32(24(4)5)18-31(23(2)3)19-33(37)25(6)7/h17-19,23-28,30,34-35,38H,1,14,20-22H2,2-13,15-16H3/t30-,34+,35+,38+/m1/s1 |
| InChIKey | IGAUADBGLPTTPQ-WWCJHDMTSA-N |
| XLogP | 9.98 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.03 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|