C29H45NO4 — CID 24851380
tert-butyl (2R,3R)-5-oxo-2-prop-2-enyl-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidine-1-carboxylate (PubChem CID 24851380) has the molecular formula C29H45NO4 and a molecular weight of 471.68 g/mol. Its IUPAC name is tert-butyl (2R,3R)-5-oxo-2-prop-2-enyl-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-5-oxo-2-prop-2-enyl-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 24851380 |
| Molecular Formula | C29H45NO4 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | tert-butyl (2R,3R)-5-oxo-2-prop-2-enyl-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H]1[C@H](O[C@@H](C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)CC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H45NO4/c1-12-13-24-25(16-26(31)30(24)28(32)34-29(9,10)11)33-20(8)27-22(18(4)5)14-21(17(2)3)15-23(27)19(6)7/h12,14-15,17-20,24-25H,1,13,16H2,2-11H3/t20-,24+,25+/m0/s1 |
| InChIKey | UAPILCGUWJTEAB-BUUDZMLXSA-N |
| XLogP | 7.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|