C25H39NO2 — CID 10643833
(4S,5S)-5-but-3-enyl-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one (PubChem CID 10643833) has the molecular formula C25H39NO2 and a molecular weight of 385.59 g/mol. Its IUPAC name is (4S,5S)-5-but-3-enyl-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one.
| Compound Name | (4S,5S)-5-but-3-enyl-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
|---|---|
| PubChem CID | 10643833 |
| Molecular Formula | C25H39NO2 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | (4S,5S)-5-but-3-enyl-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
| SMILES | C=CCC[C@@H]1NC(=O)C[C@@H]1O[C@H](C)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C25H39NO2/c1-9-10-11-22-23(14-24(27)26-22)28-18(8)25-20(16(4)5)12-19(15(2)3)13-21(25)17(6)7/h9,12-13,15-18,22-23H,1,10-11,14H2,2-8H3,(H,26,27)/t18-,22+,23+/m1/s1 |
| InChIKey | MKFOXRZYCGFKJH-LEOXJPRUSA-N |
| XLogP | 6.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|