C21H30F3NO2 — CID 143454308
N-[[5-ethyl-6-[2-methyl-5-(trifluoromethyl)phenyl]oxan-2-yl]methyl]pentanamide (PubChem CID 143454308) has the molecular formula C21H30F3NO2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-[[5-ethyl-6-[2-methyl-5-(trifluoromethyl)phenyl]oxan-2-yl]methyl]pentanamide.
| Compound Name | N-[[5-ethyl-6-[2-methyl-5-(trifluoromethyl)phenyl]oxan-2-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 143454308 |
| Molecular Formula | C21H30F3NO2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-[[5-ethyl-6-[2-methyl-5-(trifluoromethyl)phenyl]oxan-2-yl]methyl]pentanamide |
| SMILES | CCCCC(=O)NCC1CCC(CC)C(c2cc(C(F)(F)F)ccc2C)O1 |
| InChI | InChI=1S/C21H30F3NO2/c1-4-6-7-19(26)25-13-17-11-9-15(5-2)20(27-17)18-12-16(21(22,23)24)10-8-14(18)3/h8,10,12,15,17,20H,4-7,9,11,13H2,1-3H3,(H,25,26) |
| InChIKey | MNTYXHZEQJHWDH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |